C25H24N2OS2 — CID 44669516
(2Z,5E)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)-5-[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclopentan-1-one (PubChem CID 44669516) has the molecular formula C25H24N2OS2 and a molecular weight of 432.61 g/mol. Its IUPAC name is (2Z,5E)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)-5-[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclopentan-1-one.
| Compound Name | (2Z,5E)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)-5-[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 44669516 |
| Molecular Formula | C25H24N2OS2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (2Z,5E)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)-5-[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclopentan-1-one |
| SMILES | CCN1/C(=C/C=C2\CC/C(=C3/Sc4ccccc4N3CC)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C25H24N2OS2/c1-3-26-19-9-5-7-11-21(19)29-23(26)16-14-17-13-15-18(24(17)28)25-27(4-2)20-10-6-8-12-22(20)30-25/h5-12,14,16H,3-4,13,15H2,1-2H3/b17-14+,23-16-,25-18- |
| InChIKey | IKXDZJWYHLIPJC-LSDMZDAJSA-N |
| XLogP | 6.59 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|