C23H21NOS — CID 44669381
(2E)-2-[(E,4Z)-4-(3-ethyl-1,3-benzothiazol-2-ylidene)but-2-enylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 44669381) has the molecular formula C23H21NOS and a molecular weight of 359.49 g/mol. Its IUPAC name is (2E)-2-[(E,4Z)-4-(3-ethyl-1,3-benzothiazol-2-ylidene)but-2-enylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-2-[(E,4Z)-4-(3-ethyl-1,3-benzothiazol-2-ylidene)but-2-enylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 44669381 |
| Molecular Formula | C23H21NOS |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (2E)-2-[(E,4Z)-4-(3-ethyl-1,3-benzothiazol-2-ylidene)but-2-enylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | CCN1/C(=C/C=C/C=C2\CCc3ccccc3C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C23H21NOS/c1-2-24-20-12-6-7-13-21(20)26-22(24)14-8-4-10-18-16-15-17-9-3-5-11-19(17)23(18)25/h3-14H,2,15-16H2,1H3/b8-4+,18-10+,22-14- |
| InChIKey | NVVSVQLHZBDQTA-NGWBWYHZSA-N |
| XLogP | 5.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|