C14H15NOS — CID 793059
4-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-methylbut-2-enal (PubChem CID 793059) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is 4-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-methylbut-2-enal.
| Compound Name | 4-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-methylbut-2-enal |
|---|---|
| PubChem CID | 793059 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 4-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-methylbut-2-enal |
| SMILES | CCN1C(=CC=C(C)C=O)Sc2ccccc21 |
| InChI | InChI=1S/C14H15NOS/c1-3-15-12-6-4-5-7-13(12)17-14(15)9-8-11(2)10-16/h4-10H,3H2,1-2H3 |
| InChIKey | BPQZBICCGZSSDU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|