C17H18N2OS3 — CID 58081977
(5E)-3-ethyl-5-[(1Z)-1-(3-ethyl-1,3-benzothiazol-2-ylidene)propan-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 58081977) has the molecular formula C17H18N2OS3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (5E)-3-ethyl-5-[(1Z)-1-(3-ethyl-1,3-benzothiazol-2-ylidene)propan-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-ethyl-5-[(1Z)-1-(3-ethyl-1,3-benzothiazol-2-ylidene)propan-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58081977 |
| Molecular Formula | C17H18N2OS3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | (5E)-3-ethyl-5-[(1Z)-1-(3-ethyl-1,3-benzothiazol-2-ylidene)propan-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C(C)\C=C2/Sc3ccccc3N2CC)SC1=S |
| InChI | InChI=1S/C17H18N2OS3/c1-4-18-12-8-6-7-9-13(12)22-14(18)10-11(3)15-16(20)19(5-2)17(21)23-15/h6-10H,4-5H2,1-3H3/b14-10-,15-11+ |
| InChIKey | AQZRYZODWJQZRM-YCRUPXPOSA-N |
| XLogP | 4.61 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|