C17H16N2S2 — CID 703550
2-(3-ethyl-1,3-benzothiazol-2-ylidene)-N-phenylethanethioamide (PubChem CID 703550) has the molecular formula C17H16N2S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is 2-(3-ethyl-1,3-benzothiazol-2-ylidene)-N-phenylethanethioamide.
| Compound Name | 2-(3-ethyl-1,3-benzothiazol-2-ylidene)-N-phenylethanethioamide |
|---|---|
| PubChem CID | 703550 |
| Molecular Formula | C17H16N2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-(3-ethyl-1,3-benzothiazol-2-ylidene)-N-phenylethanethioamide |
| SMILES | CCN1C(=CC(=S)Nc2ccccc2)Sc2ccccc21 |
| InChI | InChI=1S/C17H16N2S2/c1-2-19-14-10-6-7-11-15(14)21-17(19)12-16(20)18-13-8-4-3-5-9-13/h3-12H,2H2,1H3,(H,18,20) |
| InChIKey | HPEMMDGYVADACB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|