C21H25NOS — CID 69167039
(2Z)-1-(1-adamantyl)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethanone (PubChem CID 69167039) has the molecular formula C21H25NOS and a molecular weight of 339.50 g/mol. Its IUPAC name is (2Z)-1-(1-adamantyl)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethanone.
| Compound Name | (2Z)-1-(1-adamantyl)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethanone |
|---|---|
| PubChem CID | 69167039 |
| Molecular Formula | C21H25NOS |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2Z)-1-(1-adamantyl)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethanone |
| SMILES | CCN1/C(=C/C(=O)C23CC4CC(CC(C4)C2)C3)Sc2ccccc21 |
| InChI | InChI=1S/C21H25NOS/c1-2-22-17-5-3-4-6-18(17)24-20(22)10-19(23)21-11-14-7-15(12-21)9-16(8-14)13-21/h3-6,10,14-16H,2,7-9,11-13H2,1H3/b20-10- |
| InChIKey | IVUBEZMTMGZLML-JMIUGGIZSA-N |
| XLogP | 5.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|