C15H14N2O2S — CID 76662087
methyl 2-cyano-4-(3-ethyl-1,3-benzothiazol-2-ylidene)but-2-enoate (PubChem CID 76662087) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is methyl 2-cyano-4-(3-ethyl-1,3-benzothiazol-2-ylidene)but-2-enoate.
| Compound Name | methyl 2-cyano-4-(3-ethyl-1,3-benzothiazol-2-ylidene)but-2-enoate |
|---|---|
| PubChem CID | 76662087 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | methyl 2-cyano-4-(3-ethyl-1,3-benzothiazol-2-ylidene)but-2-enoate |
| SMILES | CCN1C(=CC=C(C#N)C(=O)OC)Sc2ccccc21 |
| InChI | InChI=1S/C15H14N2O2S/c1-3-17-12-6-4-5-7-13(12)20-14(17)9-8-11(10-16)15(18)19-2/h4-9H,3H2,1-2H3 |
| InChIKey | VHDQDCSGLGHXOV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|