C25H26N2O2S — CID 75064886
ethyl 2-cyano-2-[7-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]acetate (PubChem CID 75064886) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is ethyl 2-cyano-2-[7-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]acetate.
| Compound Name | ethyl 2-cyano-2-[7-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]acetate |
|---|---|
| PubChem CID | 75064886 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | ethyl 2-cyano-2-[7-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]acetate |
| SMILES | CCOC(=O)C(C#N)=C1C=C2C=C(C=C3Sc4ccccc4N3CC)CCC2CC1 |
| InChI | InChI=1S/C25H26N2O2S/c1-3-27-22-7-5-6-8-23(22)30-24(27)14-17-9-10-18-11-12-19(15-20(18)13-17)21(16-26)25(28)29-4-2/h5-8,13-15,18H,3-4,9-12H2,1-2H3 |
| InChIKey | UYLRCNPAVNWIOR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|