C38H43N2O4S2+ — CID 162075235
6-[(2Z)-2-[[(7E)-7-[[3-(5-carboxypentyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-1,3-benzothiazol-3-yl]hexanoic acid (PubChem CID 162075235) has the molecular formula C38H43N2O4S2+ and a molecular weight of 655.91 g/mol. Its IUPAC name is 6-[(2Z)-2-[[(7E)-7-[[3-(5-carboxypentyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-1,3-benzothiazol-3-yl]hexanoic acid.
| Compound Name | 6-[(2Z)-2-[[(7E)-7-[[3-(5-carboxypentyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-1,3-benzothiazol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 162075235 |
| Molecular Formula | C38H43N2O4S2+ |
| Molecular Weight | 655.91 g/mol |
| Exact Mass | 655.27 |
| IUPAC Name | 6-[(2Z)-2-[[(7E)-7-[[3-(5-carboxypentyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-1,3-benzothiazol-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1/C(=C/C2=CC3=C/C(=C/c4sc5ccccc5[n+]4CCCCCC(=O)O)CCC3CC2)Sc2ccccc21 |
| InChI | InChI=1S/C38H42N2O4S2/c41-37(42)15-3-1-9-21-39-31-11-5-7-13-33(31)45-35(39)25-27-17-19-29-20-18-28(24-30(29)23-27)26-36-40(22-10-2-4-16-38(43)44)32-12-6-8-14-34(32)46-36/h5-8,11-14,23-26,29H,1-4,9-10,15-22H2,(H-,41,42,43,44)/p+1 |
| InChIKey | JRHAKMKXEUENCC-UHFFFAOYSA-O |
| XLogP | 9.37 |
| TPSA | 81.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.91 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|