C38H44N2O4S2 — CID 59907420
6-[2-[(E)-[7-[(Z)-[3-(6-oxidooxyhexyl)-1,3-benzothiazol-2-ylidene]methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]hexanoic acid (PubChem CID 59907420) has the molecular formula C38H44N2O4S2 and a molecular weight of 656.91 g/mol. Its IUPAC name is 6-[2-[(E)-[7-[(Z)-[3-(6-oxidooxyhexyl)-1,3-benzothiazol-2-ylidene]methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]hexanoic acid.
| Compound Name | 6-[2-[(E)-[7-[(Z)-[3-(6-oxidooxyhexyl)-1,3-benzothiazol-2-ylidene]methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 59907420 |
| Molecular Formula | C38H44N2O4S2 |
| Molecular Weight | 656.91 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | 6-[2-[(E)-[7-[(Z)-[3-(6-oxidooxyhexyl)-1,3-benzothiazol-2-ylidene]methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCC[n+]1c(/C=C2/C=C3C=C(/C=C4\Sc5ccccc5N4CCCCCCO[O-])CCC3CC2)sc2ccccc21 |
| InChI | InChI=1S/C38H44N2O4S2/c41-38(42)16-4-3-10-22-40-33-13-6-8-15-35(33)46-37(40)27-29-18-20-30-19-17-28(24-31(30)25-29)26-36-39(21-9-1-2-11-23-44-43)32-12-5-7-14-34(32)45-36/h5-8,12-15,24-27,30H,1-4,9-11,16-23H2,(H-,41,42,43) |
| InChIKey | KCPRGZPRCHAUPS-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.91 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|