C42H39N2S2+ — CID 74075189
3-ethyl-2-[[7-[(3-ethyl-5-phenyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-5-phenyl-1,3-benzothiazole (PubChem CID 74075189) has the molecular formula C42H39N2S2+ and a molecular weight of 635.92 g/mol. Its IUPAC name is 3-ethyl-2-[[7-[(3-ethyl-5-phenyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-5-phenyl-1,3-benzothiazole.
| Compound Name | 3-ethyl-2-[[7-[(3-ethyl-5-phenyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-5-phenyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 74075189 |
| Molecular Formula | C42H39N2S2+ |
| Molecular Weight | 635.92 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | 3-ethyl-2-[[7-[(3-ethyl-5-phenyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-5-phenyl-1,3-benzothiazole |
| SMILES | CCN1C(=CC2=CC3=CC(=Cc4sc5ccc(-c6ccccc6)cc5[n+]4CC)CCC3CC2)Sc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C42H39N2S2/c1-3-43-37-27-34(31-11-7-5-8-12-31)19-21-39(37)45-41(43)25-29-15-17-33-18-16-30(24-36(33)23-29)26-42-44(4-2)38-28-35(20-22-40(38)46-42)32-13-9-6-10-14-32/h5-14,19-28,33H,3-4,15-18H2,1-2H3/q+1 |
| InChIKey | GTWOCUWQRHOFFV-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.92 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|