C32H37N2S4+ — CID 58607716
3-ethyl-2-[(E)-[7-[(3-ethyl-5-methylsulfanyl-2H-1,3-benzothiazol-2-yl)methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]methyl]-5-methylsulfanyl-1,3-benzothiazol-3-ium (PubChem CID 58607716) has the molecular formula C32H37N2S4+ and a molecular weight of 577.93 g/mol. Its IUPAC name is 3-ethyl-2-[(E)-[7-[(3-ethyl-5-methylsulfanyl-2H-1,3-benzothiazol-2-yl)methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]methyl]-5-methylsulfanyl-1,3-benzothiazol-3-ium.
| Compound Name | 3-ethyl-2-[(E)-[7-[(3-ethyl-5-methylsulfanyl-2H-1,3-benzothiazol-2-yl)methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]methyl]-5-methylsulfanyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 58607716 |
| Molecular Formula | C32H37N2S4+ |
| Molecular Weight | 577.93 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | 3-ethyl-2-[(E)-[7-[(3-ethyl-5-methylsulfanyl-2H-1,3-benzothiazol-2-yl)methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]methyl]-5-methylsulfanyl-1,3-benzothiazol-3-ium |
| SMILES | CCN1c2cc(SC)ccc2SC1CC1=CC2=C/C(=C/c3sc4ccc(SC)cc4[n+]3CC)CCC2CC1 |
| InChI | InChI=1S/C32H37N2S4/c1-5-33-27-19-25(35-3)11-13-29(27)37-31(33)17-21-7-9-23-10-8-22(16-24(23)15-21)18-32-34(6-2)28-20-26(36-4)12-14-30(28)38-32/h11-17,19-20,23,32H,5-10,18H2,1-4H3/q+1/b21-17+ |
| InChIKey | XBQLRXOXWJRTJG-HEHNFIMWSA-N |
| XLogP | 9.44 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.93 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|