C38H35N2S4+ — CID 72511094
3-ethyl-2-[[7-[(3-ethyl-5-thiophen-2-yl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-5-thiophen-2-yl-1,3-benzothiazole (PubChem CID 72511094) has the molecular formula C38H35N2S4+ and a molecular weight of 647.98 g/mol. Its IUPAC name is 3-ethyl-2-[[7-[(3-ethyl-5-thiophen-2-yl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-5-thiophen-2-yl-1,3-benzothiazole.
| Compound Name | 3-ethyl-2-[[7-[(3-ethyl-5-thiophen-2-yl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-5-thiophen-2-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 72511094 |
| Molecular Formula | C38H35N2S4+ |
| Molecular Weight | 647.98 g/mol |
| Exact Mass | 647.17 |
| IUPAC Name | 3-ethyl-2-[[7-[(3-ethyl-5-thiophen-2-yl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-5-thiophen-2-yl-1,3-benzothiazole |
| SMILES | CCN1C(=CC2=CC3=CC(=Cc4sc5ccc(-c6cccs6)cc5[n+]4CC)CCC3CC2)Sc2ccc(-c3cccs3)cc21 |
| InChI | InChI=1S/C38H35N2S4/c1-3-39-31-23-28(33-7-5-17-41-33)13-15-35(31)43-37(39)21-25-9-11-27-12-10-26(20-30(27)19-25)22-38-40(4-2)32-24-29(14-16-36(32)44-38)34-8-6-18-42-34/h5-8,13-24,27H,3-4,9-12H2,1-2H3/q+1 |
| InChIKey | KYGPFVXXDXDESU-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.98 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|