C39H45N2S4+ — CID 20671314
5-cyclopentylsulfanyl-2-[(E)-[7-[(Z)-(5-cyclopentylsulfanyl-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]methyl]-3-methyl-1,3-benzothiazol-3-ium (PubChem CID 20671314) has the molecular formula C39H45N2S4+ and a molecular weight of 670.07 g/mol. Its IUPAC name is 5-cyclopentylsulfanyl-2-[(E)-[7-[(Z)-(5-cyclopentylsulfanyl-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]methyl]-3-methyl-1,3-benzothiazol-3-ium.
| Compound Name | 5-cyclopentylsulfanyl-2-[(E)-[7-[(Z)-(5-cyclopentylsulfanyl-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]methyl]-3-methyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 20671314 |
| Molecular Formula | C39H45N2S4+ |
| Molecular Weight | 670.07 g/mol |
| Exact Mass | 669.25 |
| IUPAC Name | 5-cyclopentylsulfanyl-2-[(E)-[7-[(Z)-(5-cyclopentylsulfanyl-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]methyl]-3-methyl-1,3-benzothiazol-3-ium |
| SMILES | CCN1/C(=C/C2=CC3=C/C(=C/c4sc5ccc(SC6CCCC6)cc5[n+]4C)CCC3CC2)Sc2ccc(SC3CCCC3)cc21 |
| InChI | InChI=1S/C39H45N2S4/c1-3-41-35-25-33(43-31-10-6-7-11-31)17-19-37(35)45-39(41)23-27-13-15-28-14-12-26(20-29(28)21-27)22-38-40(2)34-24-32(16-18-36(34)44-38)42-30-8-4-5-9-30/h16-25,28,30-31H,3-15H2,1-2H3/q+1 |
| InChIKey | IIXSFEIIXDMYCF-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.07 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|