C18H14Cl3NOS — CID 70375342
(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)-1-[3-(trichloromethyl)phenyl]ethanone (PubChem CID 70375342) has the molecular formula C18H14Cl3NOS and a molecular weight of 398.74 g/mol. Its IUPAC name is (2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)-1-[3-(trichloromethyl)phenyl]ethanone.
| Compound Name | (2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)-1-[3-(trichloromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 70375342 |
| Molecular Formula | C18H14Cl3NOS |
| Molecular Weight | 398.74 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | (2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)-1-[3-(trichloromethyl)phenyl]ethanone |
| SMILES | CCN1/C(=C/C(=O)c2cccc(C(Cl)(Cl)Cl)c2)Sc2ccccc21 |
| InChI | InChI=1S/C18H14Cl3NOS/c1-2-22-14-8-3-4-9-16(14)24-17(22)11-15(23)12-6-5-7-13(10-12)18(19,20)21/h3-11H,2H2,1H3/b17-11- |
| InChIKey | LATCFPXHHIYFPR-BOPFTXTBSA-N |
| XLogP | 6.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.74 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|