C13H16N2O3S2 — CID 70256654
(2Z)-3-ethyl-N-methyl-2-(2-oxopropylidene)-1,3-benzothiazole-5-sulfonamide (PubChem CID 70256654) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is (2Z)-3-ethyl-N-methyl-2-(2-oxopropylidene)-1,3-benzothiazole-5-sulfonamide.
| Compound Name | (2Z)-3-ethyl-N-methyl-2-(2-oxopropylidene)-1,3-benzothiazole-5-sulfonamide |
|---|---|
| PubChem CID | 70256654 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (2Z)-3-ethyl-N-methyl-2-(2-oxopropylidene)-1,3-benzothiazole-5-sulfonamide |
| SMILES | CCN1/C(=C/C(C)=O)Sc2ccc(S(=O)(=O)NC)cc21 |
| InChI | InChI=1S/C13H16N2O3S2/c1-4-15-11-8-10(20(17,18)14-3)5-6-12(11)19-13(15)7-9(2)16/h5-8,14H,4H2,1-3H3/b13-7- |
| InChIKey | GXEWZRWALHOBGA-QPEQYQDCSA-N |
| XLogP | 1.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|