C17H21NO3S — CID 75060564
[3-ethyl-2-(2-oxopropylidene)-1,3-benzothiazol-5-yl] 2,2-dimethylpropanoate (PubChem CID 75060564) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is [3-ethyl-2-(2-oxopropylidene)-1,3-benzothiazol-5-yl] 2,2-dimethylpropanoate.
| Compound Name | [3-ethyl-2-(2-oxopropylidene)-1,3-benzothiazol-5-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 75060564 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | [3-ethyl-2-(2-oxopropylidene)-1,3-benzothiazol-5-yl] 2,2-dimethylpropanoate |
| SMILES | CCN1C(=CC(C)=O)Sc2ccc(OC(=O)C(C)(C)C)cc21 |
| InChI | InChI=1S/C17H21NO3S/c1-6-18-13-10-12(21-16(20)17(3,4)5)7-8-14(13)22-15(18)9-11(2)19/h7-10H,6H2,1-5H3 |
| InChIKey | NTBMZYXPWHGTFZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|