C14H15NO3S — CID 44633738
[(2Z)-3-ethyl-2-(2-oxopropylidene)-1,3-benzothiazol-5-yl] acetate (PubChem CID 44633738) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is [(2Z)-3-ethyl-2-(2-oxopropylidene)-1,3-benzothiazol-5-yl] acetate.
| Compound Name | [(2Z)-3-ethyl-2-(2-oxopropylidene)-1,3-benzothiazol-5-yl] acetate |
|---|---|
| PubChem CID | 44633738 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | [(2Z)-3-ethyl-2-(2-oxopropylidene)-1,3-benzothiazol-5-yl] acetate |
| SMILES | CCN1/C(=C/C(C)=O)Sc2ccc(OC(C)=O)cc21 |
| InChI | InChI=1S/C14H15NO3S/c1-4-15-12-8-11(18-10(3)17)5-6-13(12)19-14(15)7-9(2)16/h5-8H,4H2,1-3H3/b14-7- |
| InChIKey | RLEOCVDWLAYGRX-AUWJEWJLSA-N |
| XLogP | 2.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|