C21H18ClN3O4S2 — CID 154396187
4-[4-[2-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonic acid (PubChem CID 154396187) has the molecular formula C21H18ClN3O4S2 and a molecular weight of 475.98 g/mol. Its IUPAC name is 4-[4-[2-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonic acid.
| Compound Name | 4-[4-[2-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 154396187 |
| Molecular Formula | C21H18ClN3O4S2 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | 4-[4-[2-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonic acid |
| SMILES | CCN1C(=CC=C2C(=O)N(c3ccc(S(=O)(=O)O)cc3)N=C2C)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H18ClN3O4S2/c1-3-24-18-12-14(22)4-10-19(18)30-20(24)11-9-17-13(2)23-25(21(17)26)15-5-7-16(8-6-15)31(27,28)29/h4-12H,3H2,1-2H3,(H,27,28,29) |
| InChIKey | MQKHFARVASJTNZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|