C28H23F3N4O4S — CID 91746018
4-[(4E)-4-[(2Z)-2-(3-ethyl-1,3-benzoxazol-2-ylidene)ethylidene]-3-methyl-5-oxopyrazol-1-yl]-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 91746018) has the molecular formula C28H23F3N4O4S and a molecular weight of 568.58 g/mol. Its IUPAC name is 4-[(4E)-4-[(2Z)-2-(3-ethyl-1,3-benzoxazol-2-ylidene)ethylidene]-3-methyl-5-oxopyrazol-1-yl]-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-[(4E)-4-[(2Z)-2-(3-ethyl-1,3-benzoxazol-2-ylidene)ethylidene]-3-methyl-5-oxopyrazol-1-yl]-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91746018 |
| Molecular Formula | C28H23F3N4O4S |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | 4-[(4E)-4-[(2Z)-2-(3-ethyl-1,3-benzoxazol-2-ylidene)ethylidene]-3-methyl-5-oxopyrazol-1-yl]-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | CCN1/C(=C/C=C2/C(=O)N(c3ccc(S(=O)(=O)Nc4cccc(C(F)(F)F)c4)cc3)N=C2C)Oc2ccccc21 |
| InChI | InChI=1S/C28H23F3N4O4S/c1-3-34-24-9-4-5-10-25(24)39-26(34)16-15-23-18(2)32-35(27(23)36)21-11-13-22(14-12-21)40(37,38)33-20-8-6-7-19(17-20)28(29,30)31/h4-17,33H,3H2,1-2H3/b23-15+,26-16- |
| InChIKey | GCRCTTAOKWTVGB-BYXGGXPLSA-N |
| XLogP | 5.92 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|