C18H19F3N2O3S — CID 25350836
N-[(2R)-butan-2-yl]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide (PubChem CID 25350836) has the molecular formula C18H19F3N2O3S and a molecular weight of 400.42 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide.
| Compound Name | N-[(2R)-butan-2-yl]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 25350836 |
| Molecular Formula | C18H19F3N2O3S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-[(2R)-butan-2-yl]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
| SMILES | CC[C@@H](C)NC(=O)c1ccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H19F3N2O3S/c1-3-12(2)22-17(24)13-7-9-16(10-8-13)27(25,26)23-15-6-4-5-14(11-15)18(19,20)21/h4-12,23H,3H2,1-2H3,(H,22,24)/t12-/m1/s1 |
| InChIKey | XCGSLDFWVULCLF-GFCCVEGCSA-N |
| XLogP | 4.03 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |