C20H23F3N2O4S — CID 4237463
N-pentan-2-yl-2-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenoxy]acetamide (PubChem CID 4237463) has the molecular formula C20H23F3N2O4S and a molecular weight of 444.48 g/mol. Its IUPAC name is N-pentan-2-yl-2-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenoxy]acetamide.
| Compound Name | N-pentan-2-yl-2-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 4237463 |
| Molecular Formula | C20H23F3N2O4S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-pentan-2-yl-2-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenoxy]acetamide |
| SMILES | CCCC(C)NC(=O)COc1ccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H23F3N2O4S/c1-3-5-14(2)24-19(26)13-29-17-8-10-18(11-9-17)30(27,28)25-16-7-4-6-15(12-16)20(21,22)23/h4,6-12,14,25H,3,5,13H2,1-2H3,(H,24,26) |
| InChIKey | NUCOAEAPTGUOAX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |