C23H21F3N2O4S — CID 126153530
2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 126153530) has the molecular formula C23H21F3N2O4S and a molecular weight of 478.49 g/mol. Its IUPAC name is 2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 126153530 |
| Molecular Formula | C23H21F3N2O4S |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(OCC(=O)Nc2cccc(C(F)(F)F)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H21F3N2O4S/c1-16(17-6-3-2-4-7-17)28-33(30,31)21-12-10-20(11-13-21)32-15-22(29)27-19-9-5-8-18(14-19)23(24,25)26/h2-14,16,28H,15H2,1H3,(H,27,29)/t16-/m1/s1 |
| InChIKey | XPUHUAIZHQAYTP-MRXNPFEDSA-N |
| XLogP | 4.76 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |