C24H24N2O6S — CID 126152181
methyl 4-[[2-[4-[[(1S)-1-phenylethyl]sulfamoyl]phenoxy]acetyl]amino]benzoate (PubChem CID 126152181) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is methyl 4-[[2-[4-[[(1S)-1-phenylethyl]sulfamoyl]phenoxy]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[4-[[(1S)-1-phenylethyl]sulfamoyl]phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126152181 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | methyl 4-[[2-[4-[[(1S)-1-phenylethyl]sulfamoyl]phenoxy]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)COc2ccc(S(=O)(=O)N[C@@H](C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O6S/c1-17(18-6-4-3-5-7-18)26-33(29,30)22-14-12-21(13-15-22)32-16-23(27)25-20-10-8-19(9-11-20)24(28)31-2/h3-15,17,26H,16H2,1-2H3,(H,25,27)/t17-/m0/s1 |
| InChIKey | QMQRQOUZZMTSBM-KRWDZBQOSA-N |
| XLogP | 3.53 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |