C26H30N2O4S — CID 126254462
N-(2,6-diethylphenyl)-2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetamide (PubChem CID 126254462) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126254462 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)COc1ccc(S(=O)(=O)N[C@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H30N2O4S/c1-4-20-12-9-13-21(5-2)26(20)27-25(29)18-32-23-14-16-24(17-15-23)33(30,31)28-19(3)22-10-7-6-8-11-22/h6-17,19,28H,4-5,18H2,1-3H3,(H,27,29)/t19-/m1/s1 |
| InChIKey | PCVMMFSWTSKWQD-LJQANCHMSA-N |
| XLogP | 4.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |