C22H20Cl2N2O4S — CID 126152019
N-(2,3-dichlorophenyl)-2-[4-[[(1S)-1-phenylethyl]sulfamoyl]phenoxy]acetamide (PubChem CID 126152019) has the molecular formula C22H20Cl2N2O4S and a molecular weight of 479.39 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[4-[[(1S)-1-phenylethyl]sulfamoyl]phenoxy]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[4-[[(1S)-1-phenylethyl]sulfamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126152019 |
| Molecular Formula | C22H20Cl2N2O4S |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[4-[[(1S)-1-phenylethyl]sulfamoyl]phenoxy]acetamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(OCC(=O)Nc2cccc(Cl)c2Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H20Cl2N2O4S/c1-15(16-6-3-2-4-7-16)26-31(28,29)18-12-10-17(11-13-18)30-14-21(27)25-20-9-5-8-19(23)22(20)24/h2-13,15,26H,14H2,1H3,(H,25,27)/t15-/m0/s1 |
| InChIKey | RIQXPOMWTHIGFN-HNNXBMFYSA-N |
| XLogP | 5.05 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |