C28H25ClN2O5S — CID 126251916
N-(5-chloro-2-phenoxyphenyl)-2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetamide (PubChem CID 126251916) has the molecular formula C28H25ClN2O5S and a molecular weight of 537.04 g/mol. Its IUPAC name is N-(5-chloro-2-phenoxyphenyl)-2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetamide.
| Compound Name | N-(5-chloro-2-phenoxyphenyl)-2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126251916 |
| Molecular Formula | C28H25ClN2O5S |
| Molecular Weight | 537.04 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | N-(5-chloro-2-phenoxyphenyl)-2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(OCC(=O)Nc2cc(Cl)ccc2Oc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H25ClN2O5S/c1-20(21-8-4-2-5-9-21)31-37(33,34)25-15-13-23(14-16-25)35-19-28(32)30-26-18-22(29)12-17-27(26)36-24-10-6-3-7-11-24/h2-18,20,31H,19H2,1H3,(H,30,32)/t20-/m1/s1 |
| InChIKey | YJIIMBKTGZQDJN-HXUWFJFHSA-N |
| XLogP | 6.19 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.04 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |