C19H20ClF3N2O3S — CID 43019696
2-chloro-N-pentan-2-yl-5-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide (PubChem CID 43019696) has the molecular formula C19H20ClF3N2O3S and a molecular weight of 448.89 g/mol. Its IUPAC name is 2-chloro-N-pentan-2-yl-5-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide.
| Compound Name | 2-chloro-N-pentan-2-yl-5-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 43019696 |
| Molecular Formula | C19H20ClF3N2O3S |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 2-chloro-N-pentan-2-yl-5-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
| SMILES | CCCC(C)NC(=O)c1cc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)ccc1Cl |
| InChI | InChI=1S/C19H20ClF3N2O3S/c1-3-5-12(2)24-18(26)16-11-15(8-9-17(16)20)29(27,28)25-14-7-4-6-13(10-14)19(21,22)23/h4,6-12,25H,3,5H2,1-2H3,(H,24,26) |
| InChIKey | PSRUUCHPJDYCHR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |