C25H23ClF3N3O7S2 — CID 142297707
4-[(4Z)-4-[(2E)-2-[5-chloro-3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]ethylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonic acid (PubChem CID 142297707) has the molecular formula C25H23ClF3N3O7S2 and a molecular weight of 634.05 g/mol. Its IUPAC name is 4-[(4Z)-4-[(2E)-2-[5-chloro-3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]ethylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonic acid.
| Compound Name | 4-[(4Z)-4-[(2E)-2-[5-chloro-3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]ethylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 142297707 |
| Molecular Formula | C25H23ClF3N3O7S2 |
| Molecular Weight | 634.05 g/mol |
| Exact Mass | 633.06 |
| IUPAC Name | 4-[(4Z)-4-[(2E)-2-[5-chloro-3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]ethylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonic acid |
| SMILES | CC1(C)/C(=C\C=C2/C(=O)N(c3ccc(S(=O)(=O)O)cc3)N=C2C(F)(F)F)N(CCCS(=O)(=O)O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H23ClF3N3O7S2/c1-24(2)19-14-15(26)4-10-20(19)31(12-3-13-40(34,35)36)21(24)11-9-18-22(25(27,28)29)30-32(23(18)33)16-5-7-17(8-6-16)41(37,38)39/h4-11,14H,3,12-13H2,1-2H3,(H,34,35,36)(H,37,38,39)/b18-9-,21-11+ |
| InChIKey | JKQTWQAVZCENBN-PNFZQLGFSA-N |
| XLogP | 4.74 |
| TPSA | 144.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.05 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|