C31H38BrN2O12S4+ — CID 90752247
2-[3-bromo-5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1-(3-sulfopropyl)indole-5-sulfonic acid (PubChem CID 90752247) has the molecular formula C31H38BrN2O12S4+ and a molecular weight of 838.82 g/mol. Its IUPAC name is 2-[3-bromo-5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1-(3-sulfopropyl)indole-5-sulfonic acid.
| Compound Name | 2-[3-bromo-5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1-(3-sulfopropyl)indole-5-sulfonic acid |
|---|---|
| PubChem CID | 90752247 |
| Molecular Formula | C31H38BrN2O12S4+ |
| Molecular Weight | 838.82 g/mol |
| Exact Mass | 837.05 |
| IUPAC Name | 2-[3-bromo-5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1-(3-sulfopropyl)indole-5-sulfonic acid |
| SMILES | CC1(C)C(=CC=C(Br)C=CC2=[N+](CCCS(=O)(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)N(CCCS(=O)(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C31H37BrN2O12S4/c1-30(2)24-19-22(49(41,42)43)9-11-26(24)33(15-5-17-47(35,36)37)28(30)13-7-21(32)8-14-29-31(3,4)25-20-23(50(44,45)46)10-12-27(25)34(29)16-6-18-48(38,39)40/h7-14,19-20H,5-6,15-18H2,1-4H3,(H3-,35,36,37,38,39,40,41,42,43,44,45,46)/p+1 |
| InChIKey | VEYTZPPZGHUKTA-UHFFFAOYSA-O |
| XLogP | 4.63 |
| TPSA | 223.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.82 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|