C31H41N2O9S3+ — CID 58195778
2-[3-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(4-sulfobutyl)indole-5-sulfonic acid (PubChem CID 58195778) has the molecular formula C31H41N2O9S3+ and a molecular weight of 681.88 g/mol. Its IUPAC name is 2-[3-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(4-sulfobutyl)indole-5-sulfonic acid.
| Compound Name | 2-[3-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(4-sulfobutyl)indole-5-sulfonic acid |
|---|---|
| PubChem CID | 58195778 |
| Molecular Formula | C31H41N2O9S3+ |
| Molecular Weight | 681.88 g/mol |
| Exact Mass | 681.20 |
| IUPAC Name | 2-[3-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(4-sulfobutyl)indole-5-sulfonic acid |
| SMILES | CC1(C)C(=CC=CC2=[N+](CCCCS(=O)(=O)O)c3ccccc3C2(C)C)N(CCCCS(=O)(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C31H40N2O9S3/c1-30(2)24-12-5-6-13-26(24)32(18-7-9-20-43(34,35)36)28(30)14-11-15-29-31(3,4)25-22-23(45(40,41)42)16-17-27(25)33(29)19-8-10-21-44(37,38)39/h5-6,11-17,22H,7-10,18-21H2,1-4H3,(H2-,34,35,36,37,38,39,40,41,42)/p+1 |
| InChIKey | RSQRWKGDHRJPIF-UHFFFAOYSA-O |
| XLogP | 4.88 |
| TPSA | 169.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.88 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|