C35H45N2O8S2+ — CID 90699822
6-[2-[5-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid (PubChem CID 90699822) has the molecular formula C35H45N2O8S2+ and a molecular weight of 685.89 g/mol. Its IUPAC name is 6-[2-[5-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid.
| Compound Name | 6-[2-[5-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 90699822 |
| Molecular Formula | C35H45N2O8S2+ |
| Molecular Weight | 685.89 g/mol |
| Exact Mass | 685.26 |
| IUPAC Name | 6-[2-[5-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid |
| SMILES | CC1(C)C(=CC=CC=CC2=[N+](CCCCS(=O)(=O)O)c3ccccc3C2(C)C)N(CCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C35H44N2O8S2/c1-34(2)27-15-10-11-16-29(27)36(23-13-14-24-46(40,41)42)31(34)17-7-5-8-18-32-35(3,4)28-25-26(47(43,44)45)20-21-30(28)37(32)22-12-6-9-19-33(38)39/h5,7-8,10-11,15-18,20-21,25H,6,9,12-14,19,22-24H2,1-4H3,(H2-,38,39,40,41,42,43,44,45)/p+1 |
| InChIKey | YNAWEIALHNYKDC-UHFFFAOYSA-O |
| XLogP | 6.42 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.89 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|