C33H41ClN3O7S2+ — CID 89289382
(2Z)-1-[3-[(2-chloroacetyl)amino]propyl]-2-[(2E,4E)-5-[3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindole-5-sulfonic acid (PubChem CID 89289382) has the molecular formula C33H41ClN3O7S2+ and a molecular weight of 691.29 g/mol. Its IUPAC name is (2Z)-1-[3-[(2-chloroacetyl)amino]propyl]-2-[(2E,4E)-5-[3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindole-5-sulfonic acid.
| Compound Name | (2Z)-1-[3-[(2-chloroacetyl)amino]propyl]-2-[(2E,4E)-5-[3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindole-5-sulfonic acid |
|---|---|
| PubChem CID | 89289382 |
| Molecular Formula | C33H41ClN3O7S2+ |
| Molecular Weight | 691.29 g/mol |
| Exact Mass | 690.21 |
| IUPAC Name | (2Z)-1-[3-[(2-chloroacetyl)amino]propyl]-2-[(2E,4E)-5-[3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindole-5-sulfonic acid |
| SMILES | CC1(C)C(/C=C/C=C/C=C2\N(CCCNC(=O)CCl)c3ccc(S(=O)(=O)O)cc3C2(C)C)=[N+](CCCS(=O)(=O)O)c2ccccc21 |
| InChI | InChI=1S/C33H40ClN3O7S2/c1-32(2)25-12-8-9-13-27(25)37(20-11-21-45(39,40)41)29(32)14-6-5-7-15-30-33(3,4)26-22-24(46(42,43)44)16-17-28(26)36(30)19-10-18-35-31(38)23-34/h5-9,12-17,22H,10-11,18-21,23H2,1-4H3,(H2-,35,38,39,40,41,42,43,44)/p+1 |
| InChIKey | RNXXZYXZRWNTOW-UHFFFAOYSA-O |
| XLogP | 5.13 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.29 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|