C33H41N2O6S2+ — CID 76662166
3-[2-[7-[3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]propane-1-sulfonic acid (PubChem CID 76662166) has the molecular formula C33H41N2O6S2+ and a molecular weight of 625.83 g/mol. Its IUPAC name is 3-[2-[7-[3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[7-[3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 76662166 |
| Molecular Formula | C33H41N2O6S2+ |
| Molecular Weight | 625.83 g/mol |
| Exact Mass | 625.24 |
| IUPAC Name | 3-[2-[7-[3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]propane-1-sulfonic acid |
| SMILES | CC1(C)C(=CC=CC=CC=CC2=[N+](CCCS(=O)(=O)O)c3ccccc3C2(C)C)N(CCCS(=O)(=O)O)c2ccccc21 |
| InChI | InChI=1S/C33H40N2O6S2/c1-32(2)26-16-10-12-18-28(26)34(22-14-24-42(36,37)38)30(32)20-8-6-5-7-9-21-31-33(3,4)27-17-11-13-19-29(27)35(31)23-15-25-43(39,40)41/h5-13,16-21H,14-15,22-25H2,1-4H3,(H-,36,37,38,39,40,41)/p+1 |
| InChIKey | SEZCIHCCXBJRPY-UHFFFAOYSA-O |
| XLogP | 5.97 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.83 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|