C36H47N2O6S2+ — CID 20611931
4-[2-[7-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]-4-methylhepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonic acid (PubChem CID 20611931) has the molecular formula C36H47N2O6S2+ and a molecular weight of 667.91 g/mol. Its IUPAC name is 4-[2-[7-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]-4-methylhepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[7-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]-4-methylhepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 20611931 |
| Molecular Formula | C36H47N2O6S2+ |
| Molecular Weight | 667.91 g/mol |
| Exact Mass | 667.29 |
| IUPAC Name | 4-[2-[7-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]-4-methylhepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonic acid |
| SMILES | CC(C=CC=C1N(CCCCS(=O)(=O)O)c2ccccc2C1(C)C)=CC=CC1=[N+](CCCCS(=O)(=O)O)c2ccccc2C1(C)C |
| InChI | InChI=1S/C36H46N2O6S2/c1-28(16-14-22-33-35(2,3)29-18-6-8-20-31(29)37(33)24-10-12-26-45(39,40)41)17-15-23-34-36(4,5)30-19-7-9-21-32(30)38(34)25-11-13-27-46(42,43)44/h6-9,14-23H,10-13,24-27H2,1-5H3,(H-,39,40,41,42,43,44)/p+1 |
| InChIKey | QFQKSYHIYHCTRS-UHFFFAOYSA-O |
| XLogP | 7.14 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.91 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|