C32H42N3O3S+ — CID 147355880
4-[2-[5-[1-(3-aminopropyl)-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonic acid (PubChem CID 147355880) has the molecular formula C32H42N3O3S+ and a molecular weight of 548.77 g/mol. Its IUPAC name is 4-[2-[5-[1-(3-aminopropyl)-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[5-[1-(3-aminopropyl)-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 147355880 |
| Molecular Formula | C32H42N3O3S+ |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | 4-[2-[5-[1-(3-aminopropyl)-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonic acid |
| SMILES | CC1(C)C(=CC=CC=CC2=[N+](CCCN)c3ccccc3C2(C)C)N(CCCCS(=O)(=O)O)c2ccccc21 |
| InChI | InChI=1S/C32H41N3O3S/c1-31(2)25-15-8-10-17-27(25)34(22-12-13-24-39(36,37)38)29(31)19-6-5-7-20-30-32(3,4)26-16-9-11-18-28(26)35(30)23-14-21-33/h5-11,15-20H,12-14,21-24,33H2,1-4H3/p+1 |
| InChIKey | DGHJVKHCLZDPRT-UHFFFAOYSA-O |
| XLogP | 5.87 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|