C32H40N3O7S2+ — CID 73314031
3-[2-[5-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfamoylindol-1-yl]propanoic acid (PubChem CID 73314031) has the molecular formula C32H40N3O7S2+ and a molecular weight of 642.82 g/mol. Its IUPAC name is 3-[2-[5-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfamoylindol-1-yl]propanoic acid.
| Compound Name | 3-[2-[5-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfamoylindol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 73314031 |
| Molecular Formula | C32H40N3O7S2+ |
| Molecular Weight | 642.82 g/mol |
| Exact Mass | 642.23 |
| IUPAC Name | 3-[2-[5-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfamoylindol-1-yl]propanoic acid |
| SMILES | CC1(C)C(=CC=CC=CC2=[N+](CCCCS(=O)(=O)O)c3ccccc3C2(C)C)N(CCC(=O)O)c2ccc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C32H39N3O7S2/c1-31(2)24-12-8-9-13-26(24)34(19-10-11-21-43(38,39)40)28(31)14-6-5-7-15-29-32(3,4)25-22-23(44(33,41)42)16-17-27(25)35(29)20-18-30(36)37/h5-9,12-17,22H,10-11,18-21H2,1-4H3,(H3-,33,36,37,38,39,40,41,42)/p+1 |
| InChIKey | INBZOGXWQLJJPH-UHFFFAOYSA-O |
| XLogP | 4.65 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.82 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|