C32H39N3O7S2 — CID 16730618
4-[2-[(1E,3E,5E)-5-[1-(2-carboxyethyl)-3,3-dimethyl-5-sulfamoylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonate (PubChem CID 16730618) has the molecular formula C32H39N3O7S2 and a molecular weight of 641.81 g/mol. Its IUPAC name is 4-[2-[(1E,3E,5E)-5-[1-(2-carboxyethyl)-3,3-dimethyl-5-sulfamoylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonate.
| Compound Name | 4-[2-[(1E,3E,5E)-5-[1-(2-carboxyethyl)-3,3-dimethyl-5-sulfamoylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 16730618 |
| Molecular Formula | C32H39N3O7S2 |
| Molecular Weight | 641.81 g/mol |
| Exact Mass | 641.22 |
| IUPAC Name | 4-[2-[(1E,3E,5E)-5-[1-(2-carboxyethyl)-3,3-dimethyl-5-sulfamoylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonate |
| SMILES | CC1(C)C(/C=C/C=C/C=C2/N(CCC(=O)O)c3ccc(S(N)(=O)=O)cc3C2(C)C)=[N+](CCCCS(=O)(=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C32H39N3O7S2/c1-31(2)24-12-8-9-13-26(24)34(19-10-11-21-43(38,39)40)28(31)14-6-5-7-15-29-32(3,4)25-22-23(44(33,41)42)16-17-27(25)35(29)20-18-30(36)37/h5-9,12-17,22H,10-11,18-21H2,1-4H3,(H3-,33,36,37,38,39,40,41,42) |
| InChIKey | INBZOGXWQLJJPH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.81 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|