C36H44N2O11S3 — CID 171902143
3-[2-[7-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]hepta-1,3,5-trienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 171902143) has the molecular formula C36H44N2O11S3 and a molecular weight of 776.95 g/mol. Its IUPAC name is 3-[2-[7-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]hepta-1,3,5-trienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[7-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]hepta-1,3,5-trienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 171902143 |
| Molecular Formula | C36H44N2O11S3 |
| Molecular Weight | 776.95 g/mol |
| Exact Mass | 776.21 |
| IUPAC Name | 3-[2-[7-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]hepta-1,3,5-trienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CC1(C)C(=CC=CC=CC=CC2=[N+](CCCS(=O)(=O)[O-])c3ccc(S(=O)(=O)O)cc3C2(C)C)N(CCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C36H44N2O11S3/c1-35(2)28-24-26(51(44,45)46)17-19-30(28)37(21-12-8-11-16-34(39)40)32(35)14-9-6-5-7-10-15-33-36(3,4)29-25-27(52(47,48)49)18-20-31(29)38(33)22-13-23-50(41,42)43/h5-7,9-10,14-15,17-20,24-25H,8,11-13,16,21-23H2,1-4H3,(H3-,39,40,41,42,43,44,45,46,47,48,49) |
| InChIKey | CXWIRZJSJHNCRY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 209.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.95 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|