C33H43N2O5S+ — CID 87413422
6-[(2E)-3,3-dimethyl-5-sulfo-2-[(E)-3-(3,3,5-trimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanoic acid (PubChem CID 87413422) has the molecular formula C33H43N2O5S+ and a molecular weight of 579.78 g/mol. Its IUPAC name is 6-[(2E)-3,3-dimethyl-5-sulfo-2-[(E)-3-(3,3,5-trimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanoic acid.
| Compound Name | 6-[(2E)-3,3-dimethyl-5-sulfo-2-[(E)-3-(3,3,5-trimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 87413422 |
| Molecular Formula | C33H43N2O5S+ |
| Molecular Weight | 579.78 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | 6-[(2E)-3,3-dimethyl-5-sulfo-2-[(E)-3-(3,3,5-trimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanoic acid |
| SMILES | CCC[N+]1=C(/C=C/C=C2/N(CCCCCC(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C33H42N2O5S/c1-7-19-34-27-17-15-23(2)21-25(27)32(3,4)29(34)12-11-13-30-33(5,6)26-22-24(41(38,39)40)16-18-28(26)35(30)20-10-8-9-14-31(36)37/h11-13,15-18,21-22H,7-10,14,19-20H2,1-6H3,(H-,36,37,38,39,40)/p+1 |
| InChIKey | BRWAKZJPJLWKHQ-UHFFFAOYSA-O |
| XLogP | 6.91 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.78 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|