C39H57N2O2S+ — CID 59042800
(2Z)-1-heptyl-2-[(E)-3-(1-heptyl-3,3-dimethyl-5-methylsulfonylindol-1-ium-2-yl)prop-2-enylidene]-3,3,5-trimethylindole (PubChem CID 59042800) has the molecular formula C39H57N2O2S+ and a molecular weight of 617.96 g/mol. Its IUPAC name is (2Z)-1-heptyl-2-[(E)-3-(1-heptyl-3,3-dimethyl-5-methylsulfonylindol-1-ium-2-yl)prop-2-enylidene]-3,3,5-trimethylindole.
| Compound Name | (2Z)-1-heptyl-2-[(E)-3-(1-heptyl-3,3-dimethyl-5-methylsulfonylindol-1-ium-2-yl)prop-2-enylidene]-3,3,5-trimethylindole |
|---|---|
| PubChem CID | 59042800 |
| Molecular Formula | C39H57N2O2S+ |
| Molecular Weight | 617.96 g/mol |
| Exact Mass | 617.41 |
| IUPAC Name | (2Z)-1-heptyl-2-[(E)-3-(1-heptyl-3,3-dimethyl-5-methylsulfonylindol-1-ium-2-yl)prop-2-enylidene]-3,3,5-trimethylindole |
| SMILES | CCCCCCCN1/C(=C\C=C\C2=[N+](CCCCCCC)c3ccc(S(C)(=O)=O)cc3C2(C)C)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C39H57N2O2S/c1-9-11-13-15-17-26-40-34-24-22-30(3)28-32(34)38(4,5)36(40)20-19-21-37-39(6,7)33-29-31(44(8,42)43)23-25-35(33)41(37)27-18-16-14-12-10-2/h19-25,28-29H,9-18,26-27H2,1-8H3/q+1 |
| InChIKey | GBGBASOEDPIACO-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.96 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|