C30H39N2O11S4+ — CID 20611960
2-[(2E)-2-[(E)-3-[3,3-dimethyl-1-(2-sulfoethyl)-5-(2-sulfoethylsulfonyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3,5-trimethylindol-1-yl]ethanesulfonic acid (PubChem CID 20611960) has the molecular formula C30H39N2O11S4+ and a molecular weight of 731.91 g/mol. Its IUPAC name is 2-[(2E)-2-[(E)-3-[3,3-dimethyl-1-(2-sulfoethyl)-5-(2-sulfoethylsulfonyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3,5-trimethylindol-1-yl]ethanesulfonic acid.
| Compound Name | 2-[(2E)-2-[(E)-3-[3,3-dimethyl-1-(2-sulfoethyl)-5-(2-sulfoethylsulfonyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3,5-trimethylindol-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 20611960 |
| Molecular Formula | C30H39N2O11S4+ |
| Molecular Weight | 731.91 g/mol |
| Exact Mass | 731.14 |
| IUPAC Name | 2-[(2E)-2-[(E)-3-[3,3-dimethyl-1-(2-sulfoethyl)-5-(2-sulfoethylsulfonyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3,5-trimethylindol-1-yl]ethanesulfonic acid |
| SMILES | Cc1ccc2c(c1)C(C)(C)/C(=C\C=C\C1=[N+](CCS(=O)(=O)O)c3ccc(S(=O)(=O)CCS(=O)(=O)O)cc3C1(C)C)N2CCS(=O)(=O)O |
| InChI | InChI=1S/C30H38N2O11S4/c1-21-9-11-25-23(19-21)29(2,3)27(31(25)13-15-45(35,36)37)7-6-8-28-30(4,5)24-20-22(44(33,34)17-18-47(41,42)43)10-12-26(24)32(28)14-16-46(38,39)40/h6-12,19-20H,13-18H2,1-5H3,(H2-,35,36,37,38,39,40,41,42,43)/p+1 |
| InChIKey | NFKOTMVQKRHCJX-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 203.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.91 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|