C35H53N2O12S2Si2+ — CID 75112413
2-[3-[3,3-dimethyl-5-sulfo-1-(3-trimethoxysilylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-trimethoxysilylpropyl)indole-5-sulfonic acid (PubChem CID 75112413) has the molecular formula C35H53N2O12S2Si2+ and a molecular weight of 814.12 g/mol. Its IUPAC name is 2-[3-[3,3-dimethyl-5-sulfo-1-(3-trimethoxysilylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-trimethoxysilylpropyl)indole-5-sulfonic acid.
| Compound Name | 2-[3-[3,3-dimethyl-5-sulfo-1-(3-trimethoxysilylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-trimethoxysilylpropyl)indole-5-sulfonic acid |
|---|---|
| PubChem CID | 75112413 |
| Molecular Formula | C35H53N2O12S2Si2+ |
| Molecular Weight | 814.12 g/mol |
| Exact Mass | 813.26 |
| IUPAC Name | 2-[3-[3,3-dimethyl-5-sulfo-1-(3-trimethoxysilylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-trimethoxysilylpropyl)indole-5-sulfonic acid |
| SMILES | CO[Si](CCCN1C(=CC=CC2=[N+](CCC[Si](OC)(OC)OC)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)O)ccc21)(OC)OC |
| InChI | InChI=1S/C35H52N2O12S2Si2/c1-34(2)28-24-26(50(38,39)40)16-18-30(28)36(20-12-22-52(44-5,45-6)46-7)32(34)14-11-15-33-35(3,4)29-25-27(51(41,42)43)17-19-31(29)37(33)21-13-23-53(47-8,48-9)49-10/h11,14-19,24-25H,12-13,20-23H2,1-10H3,(H-,38,39,40,41,42,43)/p+1 |
| InChIKey | IVIDDLXCUASRJO-UHFFFAOYSA-O |
| XLogP | 5.33 |
| TPSA | 170.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.12 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|