C28H35N2O12S4+ — CID 59098575
2-[(3E)-3-[3,3-dimethyl-1-(2-sulfoethyl)-5-(trioxidanylsulfanyl)indol-2-ylidene]prop-1-enyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid (PubChem CID 59098575) has the molecular formula C28H35N2O12S4+ and a molecular weight of 719.86 g/mol. Its IUPAC name is 2-[(3E)-3-[3,3-dimethyl-1-(2-sulfoethyl)-5-(trioxidanylsulfanyl)indol-2-ylidene]prop-1-enyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid.
| Compound Name | 2-[(3E)-3-[3,3-dimethyl-1-(2-sulfoethyl)-5-(trioxidanylsulfanyl)indol-2-ylidene]prop-1-enyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 59098575 |
| Molecular Formula | C28H35N2O12S4+ |
| Molecular Weight | 719.86 g/mol |
| Exact Mass | 719.11 |
| IUPAC Name | 2-[(3E)-3-[3,3-dimethyl-1-(2-sulfoethyl)-5-(trioxidanylsulfanyl)indol-2-ylidene]prop-1-enyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
| SMILES | CC1(C)C(C=C/C=C2/N(CCS(=O)(=O)O)c3ccc(SOOO)cc3C2(C)C)=[N+](CCCS(=O)(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C28H34N2O12S4/c1-27(2)21-17-19(43-42-41-31)9-11-23(21)30(14-16-45(35,36)37)26(27)8-5-7-25-28(3,4)22-18-20(46(38,39)40)10-12-24(22)29(25)13-6-15-44(32,33)34/h5,7-12,17-18H,6,13-16H2,1-4H3,(H3-,31,32,33,34,35,36,37,38,39,40)/p+1 |
| InChIKey | BTHFNGNWSVHEHQ-UHFFFAOYSA-O |
| XLogP | 4.14 |
| TPSA | 208.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.86 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|