C25H29N2O12S4+ — CID 58648847
2-[3-[3,3-dimethyl-1-(sulfomethyl)-5-(trioxidanylsulfanyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(sulfomethyl)indole-5-sulfonic acid (PubChem CID 58648847) has the molecular formula C25H29N2O12S4+ and a molecular weight of 677.78 g/mol. Its IUPAC name is 2-[3-[3,3-dimethyl-1-(sulfomethyl)-5-(trioxidanylsulfanyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(sulfomethyl)indole-5-sulfonic acid.
| Compound Name | 2-[3-[3,3-dimethyl-1-(sulfomethyl)-5-(trioxidanylsulfanyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(sulfomethyl)indole-5-sulfonic acid |
|---|---|
| PubChem CID | 58648847 |
| Molecular Formula | C25H29N2O12S4+ |
| Molecular Weight | 677.78 g/mol |
| Exact Mass | 677.06 |
| IUPAC Name | 2-[3-[3,3-dimethyl-1-(sulfomethyl)-5-(trioxidanylsulfanyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(sulfomethyl)indole-5-sulfonic acid |
| SMILES | CC1(C)C(=CC=CC2=[N+](CS(=O)(=O)O)c3ccc(SOOO)cc3C2(C)C)N(CS(=O)(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C25H28N2O12S4/c1-24(2)18-12-16(40-39-38-28)8-10-20(18)26(14-41(29,30)31)22(24)6-5-7-23-25(3,4)19-13-17(43(35,36)37)9-11-21(19)27(23)15-42(32,33)34/h5-13H,14-15H2,1-4H3,(H3-,28,29,30,31,32,33,34,35,36,37)/p+1 |
| InChIKey | FVGZQJIZGYEGRR-UHFFFAOYSA-O |
| XLogP | 3.67 |
| TPSA | 208.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.78 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|