C39H45N2O8S2+ — CID 72655920
6-[2-[7-(1-ethyl-3,3-dimethyl-5-sulfoindol-2-ylidene)hepta-1,3,5-trienyl]-1,1-dimethyl-7-(trioxidanylsulfanyl)benzo[e]indol-3-ium-3-yl]hexanoic acid (PubChem CID 72655920) has the molecular formula C39H45N2O8S2+ and a molecular weight of 733.93 g/mol. Its IUPAC name is 6-[2-[7-(1-ethyl-3,3-dimethyl-5-sulfoindol-2-ylidene)hepta-1,3,5-trienyl]-1,1-dimethyl-7-(trioxidanylsulfanyl)benzo[e]indol-3-ium-3-yl]hexanoic acid.
| Compound Name | 6-[2-[7-(1-ethyl-3,3-dimethyl-5-sulfoindol-2-ylidene)hepta-1,3,5-trienyl]-1,1-dimethyl-7-(trioxidanylsulfanyl)benzo[e]indol-3-ium-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 72655920 |
| Molecular Formula | C39H45N2O8S2+ |
| Molecular Weight | 733.93 g/mol |
| Exact Mass | 733.26 |
| IUPAC Name | 6-[2-[7-(1-ethyl-3,3-dimethyl-5-sulfoindol-2-ylidene)hepta-1,3,5-trienyl]-1,1-dimethyl-7-(trioxidanylsulfanyl)benzo[e]indol-3-ium-3-yl]hexanoic acid |
| SMILES | CCN1C(=CC=CC=CC=CC2=[N+](CCCCCC(=O)O)c3ccc4cc(SOOO)ccc4c3C2(C)C)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C39H44N2O8S2/c1-6-40-32-23-20-29(51(45,46)47)26-31(32)38(2,3)34(40)15-11-8-7-9-12-16-35-39(4,5)37-30-21-19-28(50-49-48-44)25-27(30)18-22-33(37)41(35)24-14-10-13-17-36(42)43/h7-9,11-12,15-16,18-23,25-26H,6,10,13-14,17,24H2,1-5H3,(H2-,42,43,44,45,46,47)/p+1 |
| InChIKey | PNLZGCTYNWQWIJ-UHFFFAOYSA-O |
| XLogP | 8.91 |
| TPSA | 136.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.93 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|