C37H49N2O10S2+ — CID 59080743
6-[(2E)-2-[(2E)-2-[[1-(5-carboxypentyl)-3,3-dimethyl-5-(trioxidanylsulfanyl)indol-1-ium-2-yl]methylidene]butylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid (PubChem CID 59080743) has the molecular formula C37H49N2O10S2+ and a molecular weight of 745.94 g/mol. Its IUPAC name is 6-[(2E)-2-[(2E)-2-[[1-(5-carboxypentyl)-3,3-dimethyl-5-(trioxidanylsulfanyl)indol-1-ium-2-yl]methylidene]butylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid.
| Compound Name | 6-[(2E)-2-[(2E)-2-[[1-(5-carboxypentyl)-3,3-dimethyl-5-(trioxidanylsulfanyl)indol-1-ium-2-yl]methylidene]butylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 59080743 |
| Molecular Formula | C37H49N2O10S2+ |
| Molecular Weight | 745.94 g/mol |
| Exact Mass | 745.28 |
| IUPAC Name | 6-[(2E)-2-[(2E)-2-[[1-(5-carboxypentyl)-3,3-dimethyl-5-(trioxidanylsulfanyl)indol-1-ium-2-yl]methylidene]butylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid |
| SMILES | CCC(=C\C1=[N+](CCCCCC(=O)O)c2ccc(SOOO)cc2C1(C)C)/C=C1/N(CCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)C |
| InChI | InChI=1S/C37H48N2O10S2/c1-6-25(21-32-36(2,3)28-23-26(50-49-48-44)15-17-30(28)38(32)19-11-7-9-13-34(40)41)22-33-37(4,5)29-24-27(51(45,46)47)16-18-31(29)39(33)20-12-8-10-14-35(42)43/h15-18,21-24H,6-14,19-20H2,1-5H3,(H3-,40,41,42,43,44,45,46,47)/p+1 |
| InChIKey | PHFFISCWKHMSIW-UHFFFAOYSA-O |
| XLogP | 8.05 |
| TPSA | 173.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.94 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|