C34H43N2O11S3+ — CID 129303807
6-[(2E)-2-[(2E,4E)-5-[3,3-dimethyl-4-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid (PubChem CID 129303807) has the molecular formula C34H43N2O11S3+ and a molecular weight of 751.92 g/mol. Its IUPAC name is 6-[(2E)-2-[(2E,4E)-5-[3,3-dimethyl-4-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid.
| Compound Name | 6-[(2E)-2-[(2E,4E)-5-[3,3-dimethyl-4-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 129303807 |
| Molecular Formula | C34H43N2O11S3+ |
| Molecular Weight | 751.92 g/mol |
| Exact Mass | 751.20 |
| IUPAC Name | 6-[(2E)-2-[(2E,4E)-5-[3,3-dimethyl-4-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid |
| SMILES | CC1(C)C(/C=C/C=C/C=C2/N(CCCCCC(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)=[N+](CCCS(=O)(=O)O)c2cccc(S(=O)(=O)O)c21 |
| InChI | InChI=1S/C34H42N2O11S3/c1-33(2)25-23-24(49(42,43)44)18-19-26(25)35(20-10-6-9-17-31(37)38)29(33)15-7-5-8-16-30-34(3,4)32-27(13-11-14-28(32)50(45,46)47)36(30)21-12-22-48(39,40)41/h5,7-8,11,13-16,18-19,23H,6,9-10,12,17,20-22H2,1-4H3,(H3-,37,38,39,40,41,42,43,44,45,46,47)/p+1 |
| InChIKey | FSPPVCJSEQSZDW-UHFFFAOYSA-O |
| XLogP | 5.27 |
| TPSA | 206.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.92 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|