C32H41N2O11S3+ — CID 123423307
6-[2-[3-[3,3-dimethyl-7-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid (PubChem CID 123423307) has the molecular formula C32H41N2O11S3+ and a molecular weight of 725.88 g/mol. Its IUPAC name is 6-[2-[3-[3,3-dimethyl-7-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid.
| Compound Name | 6-[2-[3-[3,3-dimethyl-7-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 123423307 |
| Molecular Formula | C32H41N2O11S3+ |
| Molecular Weight | 725.88 g/mol |
| Exact Mass | 725.19 |
| IUPAC Name | 6-[2-[3-[3,3-dimethyl-7-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid |
| SMILES | CC1(C)C(=CC=CC2=[N+](CCCS(=O)(=O)O)c3c(cccc3S(=O)(=O)O)C2(C)C)N(CCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C32H40N2O11S3/c1-31(2)23-11-8-12-26(48(43,44)45)30(23)34(19-10-20-46(37,38)39)28(31)14-9-13-27-32(3,4)24-21-22(47(40,41)42)16-17-25(24)33(27)18-7-5-6-15-29(35)36/h8-9,11-14,16-17,21H,5-7,10,15,18-20H2,1-4H3,(H3-,35,36,37,38,39,40,41,42,43,44,45)/p+1 |
| InChIKey | KLTUYESPWJZRIZ-UHFFFAOYSA-O |
| XLogP | 4.72 |
| TPSA | 206.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.88 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|