C42H53N2O4S+ — CID 171470529
(2E)-1-(7,7-dimethyl-6-oxooctyl)-2-[(E)-3-[3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid (PubChem CID 171470529) has the molecular formula C42H53N2O4S+ and a molecular weight of 681.96 g/mol. Its IUPAC name is (2E)-1-(7,7-dimethyl-6-oxooctyl)-2-[(E)-3-[3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid.
| Compound Name | (2E)-1-(7,7-dimethyl-6-oxooctyl)-2-[(E)-3-[3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid |
|---|---|
| PubChem CID | 171470529 |
| Molecular Formula | C42H53N2O4S+ |
| Molecular Weight | 681.96 g/mol |
| Exact Mass | 681.37 |
| IUPAC Name | (2E)-1-(7,7-dimethyl-6-oxooctyl)-2-[(E)-3-[3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid |
| SMILES | CC(C)(C)C(=O)CCCCCN1/C(=C/C=C/C2=[N+](CCCc3ccccc3)c3ccccc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C42H52N2O4S/c1-40(2,3)39(45)25-12-9-15-28-43-36-27-26-32(49(46,47)48)30-34(36)42(6,7)38(43)24-16-23-37-41(4,5)33-21-13-14-22-35(33)44(37)29-17-20-31-18-10-8-11-19-31/h8,10-11,13-14,16,18-19,21-24,26-27,30H,9,12,15,17,20,25,28-29H2,1-7H3/p+1 |
| InChIKey | NAGJCUMOFAAASL-UHFFFAOYSA-O |
| XLogP | 9.36 |
| TPSA | 77.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.96 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|